About 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine
3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine (PubChem CID 170384964) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine |
| PubChem CID | 170384964 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine |
| SMILES | CCCNCC(NCCC)C(C)CC(C)C |
| InChI | InChI=1S/C14H32N2/c1-6-8-15-11-14(16-9-7-2)13(5)10-12(3)4/h12-16H,6-11H2,1-5H3 |
| InChIKey | XBTAICOCFUJREV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine?
The IUPAC name of 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine (CID 170384964) is 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine.
What is the SMILES notation for 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine?
The canonical SMILES for 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine is CCCNCC(NCCC)C(C)CC(C)C.
What is the InChIKey of 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine?
The InChIKey is XBTAICOCFUJREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2/c1-6-8-15-11-14(16-9-7-2)13(5)10-12(3)4/h12-16H,6-11H2,1-5H3.
What are the key properties of 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine?
3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine has a molecular weight of 228.42 g/mol, XLogP of 3.04, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-N,2-N-dipropylhexane-1,2-diamine is sourced from PubChem (CID 170384964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).