About 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine
2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine (PubChem CID 170385548) has the molecular formula C19H18INS2
and a molecular weight of 451.40 g/mol. Its IUPAC name is 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine.
Molecular Properties
| Compound Name | 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine |
| PubChem CID | 170385548 |
| Molecular Formula | C19H18INS2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine |
| SMILES | Cc1sc2c(c1C)C(I)CC(Cc1cc3c(N)cccc3s1)=C2 |
| InChI | InChI=1S/C19H18INS2/c1-10-11(2)22-18-8-12(7-15(20)19(10)18)6-13-9-14-16(21)4-3-5-17(14)23-13/h3-5,8-9,15H,6-7,21H2,1-2H3 |
| InChIKey | PGEWMWRTZDJEQC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine?
The IUPAC name of 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine (CID 170385548) is 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine.
What is the SMILES notation for 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine?
The canonical SMILES for 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine is Cc1sc2c(c1C)C(I)CC(Cc1cc3c(N)cccc3s1)=C2.
What is the InChIKey of 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine?
The InChIKey is PGEWMWRTZDJEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18INS2/c1-10-11(2)22-18-8-12(7-15(20)19(10)18)6-13-9-14-16(21)4-3-5-17(14)23-13/h3-5,8-9,15H,6-7,21H2,1-2H3.
What are the key properties of 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine?
2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine has a molecular weight of 451.40 g/mol, XLogP of 6.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-iodo-2,3-dimethyl-4,5-dihydro-1-benzothiophen-6-yl)methyl]-1-benzothiophen-4-amine is sourced from PubChem (CID 170385548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).