C19H31FN4O3S — CID 170385642
N-[(2R,3S,5R)-2-[[(1S,3S,4S)-4-(5-fluoropyrimidin-2-yl)-3,4-dimethylcyclohexyl]oxymethyl]-5-methylpyrrolidin-3-yl]methanesulfonamide (PubChem CID 170385642) has the molecular formula C19H31FN4O3S and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[(2R,3S,5R)-2-[[(1S,3S,4S)-4-(5-fluoropyrimidin-2-yl)-3,4-dimethylcyclohexyl]oxymethyl]-5-methylpyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[(2R,3S,5R)-2-[[(1S,3S,4S)-4-(5-fluoropyrimidin-2-yl)-3,4-dimethylcyclohexyl]oxymethyl]-5-methylpyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170385642 |
| Molecular Formula | C19H31FN4O3S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[(2R,3S,5R)-2-[[(1S,3S,4S)-4-(5-fluoropyrimidin-2-yl)-3,4-dimethylcyclohexyl]oxymethyl]-5-methylpyrrolidin-3-yl]methanesulfonamide |
| SMILES | C[C@@H]1C[C@H](NS(C)(=O)=O)[C@H](CO[C@H]2CC[C@](C)(c3ncc(F)cn3)[C@@H](C)C2)N1 |
| InChI | InChI=1S/C19H31FN4O3S/c1-12-7-15(5-6-19(12,3)18-21-9-14(20)10-22-18)27-11-17-16(8-13(2)23-17)24-28(4,25)26/h9-10,12-13,15-17,23-24H,5-8,11H2,1-4H3/t12-,13+,15-,16-,17-,19-/m0/s1 |
| InChIKey | WEIJPQFDERVPPZ-YOMBCDGJSA-N |
| XLogP | 1.75 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |