About (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane
(2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 170385886) has the molecular formula C12H22FNO
and a molecular weight of 215.31 g/mol. Its IUPAC name is (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane |
| PubChem CID | 170385886 |
| Molecular Formula | C12H22FNO |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | CN1CC2C(C1COC(C)(C)C)C2(C)F |
| InChI | InChI=1S/C12H22FNO/c1-11(2,3)15-7-9-10-8(6-14(9)5)12(10,4)13/h8-10H,6-7H2,1-5H3 |
| InChIKey | FMMBDEJBBQJGIO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane?
The IUPAC name of (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane (CID 170385886) is (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane is CN1CC2C(C1COC(C)(C)C)C2(C)F.
What is the InChIKey of (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane?
The InChIKey is FMMBDEJBBQJGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22FNO/c1-11(2,3)15-7-9-10-8(6-14(9)5)12(10,4)13/h8-10H,6-7H2,1-5H3.
What are the key properties of (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane?
(2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane has a molecular weight of 215.31 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-fluoro-3,6-dimethyl-2-[(2-methylpropan-2-yl)oxymethyl]-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 170385886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).