C16H21F2N5O — CID 170386368
2-[(Z)-1-amino-2-(7-amino-2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4,6-difluorophenol (PubChem CID 170386368) has the molecular formula C16H21F2N5O and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-(7-amino-2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4,6-difluorophenol.
| Compound Name | 2-[(Z)-1-amino-2-(7-amino-2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4,6-difluorophenol |
|---|---|
| PubChem CID | 170386368 |
| Molecular Formula | C16H21F2N5O |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[(Z)-1-amino-2-(7-amino-2-methyl-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl)ethenyl]-4,6-difluorophenol |
| SMILES | CN1CCN2C(/C=C(\N)c3cc(F)cc(F)c3O)=C(N)NCC2C1 |
| InChI | InChI=1S/C16H21F2N5O/c1-22-2-3-23-10(8-22)7-21-16(20)14(23)6-13(19)11-4-9(17)5-12(18)15(11)24/h4-6,10,21,24H,2-3,7-8,19-20H2,1H3/b13-6- |
| InChIKey | LDQOGDSZYZFZNB-MLPAPPSSSA-N |
| XLogP | 0.32 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |