C21H24FN7O2 — CID 170386372
[(4R)-4-[(E)-[(2Z)-2-ethylidene-6-methyl-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone (PubChem CID 170386372) has the molecular formula C21H24FN7O2 and a molecular weight of 425.47 g/mol. Its IUPAC name is [(4R)-4-[(E)-[(2Z)-2-ethylidene-6-methyl-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone.
| Compound Name | [(4R)-4-[(E)-[(2Z)-2-ethylidene-6-methyl-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 170386372 |
| Molecular Formula | C21H24FN7O2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [(4R)-4-[(E)-[(2Z)-2-ethylidene-6-methyl-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone |
| SMILES | C/C=C1/C=CC=C(C)N1/N=C/[C@H]1c2nc[nH]c2CCN1C(=O)c1nnc(C(C)(C)F)o1 |
| InChI | InChI=1S/C21H24FN7O2/c1-5-14-8-6-7-13(2)29(14)25-11-16-17-15(23-12-24-17)9-10-28(16)19(30)18-26-27-20(31-18)21(3,4)22/h5-8,11-12,16H,9-10H2,1-4H3,(H,23,24)/b14-5-,25-11+/t16-/m0/s1 |
| InChIKey | BRRHHACFPXITMW-RPPMKXQMSA-N |
| XLogP | 3.40 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|