C20H21F2N7O2 — CID 170386480
[(4R)-4-[(E)-[(2Z)-2-ethylidene-6-fluoro-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone (PubChem CID 170386480) has the molecular formula C20H21F2N7O2 and a molecular weight of 429.43 g/mol. Its IUPAC name is [(4R)-4-[(E)-[(2Z)-2-ethylidene-6-fluoro-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone.
| Compound Name | [(4R)-4-[(E)-[(2Z)-2-ethylidene-6-fluoro-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 170386480 |
| Molecular Formula | C20H21F2N7O2 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [(4R)-4-[(E)-[(2Z)-2-ethylidene-6-fluoro-1-pyridinyl]iminomethyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]-[5-(2-fluoropropan-2-yl)-1,3,4-oxadiazol-2-yl]methanone |
| SMILES | C/C=C1/C=CC=C(F)N1/N=C/[C@H]1c2nc[nH]c2CCN1C(=O)c1nnc(C(C)(C)F)o1 |
| InChI | InChI=1S/C20H21F2N7O2/c1-4-12-6-5-7-15(21)29(12)25-10-14-16-13(23-11-24-16)8-9-28(14)18(30)17-26-27-19(31-17)20(2,3)22/h4-7,10-11,14H,8-9H2,1-3H3,(H,23,24)/b12-4-,25-10+/t14-/m0/s1 |
| InChIKey | ZZJCNJRIMYGFLJ-CONILDDYSA-N |
| XLogP | 3.31 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|