About (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one
(3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one (PubChem CID 17038677) has the molecular formula C18H17NO3S
and a molecular weight of 327.41 g/mol. Its IUPAC name is (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one.
Molecular Properties
| Compound Name | (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one |
| PubChem CID | 17038677 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one |
| SMILES | CC(C)N1/C(=C/c2ccccc2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H17NO3S/c1-13(2)19-16(12-14-8-4-3-5-9-14)18(20)15-10-6-7-11-17(15)23(19,21)22/h3-13H,1-2H3/b16-12+ |
| InChIKey | ADCRLKRQMNZQIP-FOWTUZBSSA-N |
| XLogP | 3.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one?
The IUPAC name of (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one (CID 17038677) is (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one.
What is the SMILES notation for (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one?
The canonical SMILES for (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one is CC(C)N1/C(=C/c2ccccc2)C(=O)c2ccccc2S1(=O)=O.
What is the InChIKey of (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one?
The InChIKey is ADCRLKRQMNZQIP-FOWTUZBSSA-N. The full InChI is InChI=1S/C18H17NO3S/c1-13(2)19-16(12-14-8-4-3-5-9-14)18(20)15-10-6-7-11-17(15)23(19,21)22/h3-13H,1-2H3/b16-12+.
What are the key properties of (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one?
(3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one has a molecular weight of 327.41 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-benzylidene-1,1-dioxo-2-propan-2-yl-1λ6,2-benzothiazin-4-one is sourced from PubChem (CID 17038677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).