About 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete
2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete (PubChem CID 170387702) has the molecular formula C19H35N
and a molecular weight of 277.50 g/mol. Its IUPAC name is 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete.
Molecular Properties
| Compound Name | 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete |
| PubChem CID | 170387702 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete |
| SMILES | C/C=C(\CC(C)CCCCC)C(C)C1N=CC1CCC |
| InChI | InChI=1S/C19H35N/c1-6-9-10-12-15(4)13-17(8-3)16(5)19-18(11-7-2)14-20-19/h8,14-16,18-19H,6-7,9-13H2,1-5H3/b17-8+ |
| InChIKey | VBBYDHXAYBIBLR-CAOOACKPSA-N |
| XLogP | 6.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete?
The IUPAC name of 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete (CID 170387702) is 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete.
What is the SMILES notation for 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete?
The canonical SMILES for 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete is C/C=C(\CC(C)CCCCC)C(C)C1N=CC1CCC.
What is the InChIKey of 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete?
The InChIKey is VBBYDHXAYBIBLR-CAOOACKPSA-N. The full InChI is InChI=1S/C19H35N/c1-6-9-10-12-15(4)13-17(8-3)16(5)19-18(11-7-2)14-20-19/h8,14-16,18-19H,6-7,9-13H2,1-5H3/b17-8+.
What are the key properties of 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete?
2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete has a molecular weight of 277.50 g/mol, XLogP of 6.04, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E)-3-ethylidene-5-methyldecan-2-yl]-3-propyl-2,3-dihydroazete is sourced from PubChem (CID 170387702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).