About ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate
ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate (PubChem CID 170387969) has the molecular formula C20H20O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate |
| PubChem CID | 170387969 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2cccc(OC)c2)C(c2c#cccc2)[C@@H]1C |
| InChI | InChI=1S/C20H20O3/c1-4-23-19(21)20(16-11-8-12-17(13-16)22-3)14(2)18(20)15-9-6-5-7-10-15/h5-6,8-9,11-14,18H,4H2,1-3H3/t14-,18?,20?/m0/s1 |
| InChIKey | BFDLOYFFQYSLLC-KLOIUYPJSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate?
The IUPAC name of ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate (CID 170387969) is ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate.
What is the SMILES notation for ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate?
The canonical SMILES for ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate is CCOC(=O)C1(c2cccc(OC)c2)C(c2c#cccc2)[C@@H]1C.
What is the InChIKey of ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate?
The InChIKey is BFDLOYFFQYSLLC-KLOIUYPJSA-N. The full InChI is InChI=1S/C20H20O3/c1-4-23-19(21)20(16-11-8-12-17(13-16)22-3)14(2)18(20)15-9-6-5-7-10-15/h5-6,8-9,11-14,18H,4H2,1-3H3/t14-,18?,20?/m0/s1.
What are the key properties of ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate?
ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate has a molecular weight of 308.38 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-2-cyclohexa-1,3-dien-5-yn-1-yl-1-(3-methoxyphenyl)-3-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 170387969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).