C32H27NO5 — CID 170389022
[3-(2-oxo-1,3-dihydroindol-6-yl)phenyl] (2R)-3-(dihydroxymethyl)-2,4-diphenylcyclobutane-1-carboxylate (PubChem CID 170389022) has the molecular formula C32H27NO5 and a molecular weight of 505.57 g/mol. Its IUPAC name is [3-(2-oxo-1,3-dihydroindol-6-yl)phenyl] (2R)-3-(dihydroxymethyl)-2,4-diphenylcyclobutane-1-carboxylate.
| Compound Name | [3-(2-oxo-1,3-dihydroindol-6-yl)phenyl] (2R)-3-(dihydroxymethyl)-2,4-diphenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 170389022 |
| Molecular Formula | C32H27NO5 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | [3-(2-oxo-1,3-dihydroindol-6-yl)phenyl] (2R)-3-(dihydroxymethyl)-2,4-diphenylcyclobutane-1-carboxylate |
| SMILES | O=C1Cc2ccc(-c3cccc(OC(=O)C4C(c5ccccc5)C(C(O)O)[C@H]4c4ccccc4)c3)cc2N1 |
| InChI | InChI=1S/C32H27NO5/c34-26-18-23-15-14-22(17-25(23)33-26)21-12-7-13-24(16-21)38-32(37)30-27(19-8-3-1-4-9-19)29(31(35)36)28(30)20-10-5-2-6-11-20/h1-17,27-31,35-36H,18H2,(H,33,34)/t27-,28?,29?,30?/m1/s1 |
| InChIKey | CSLZNVWASBLOCU-TWHSRUFXSA-N |
| XLogP | 4.88 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|