About 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol
2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol (PubChem CID 170389293) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol |
| PubChem CID | 170389293 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol |
| SMILES | CC1C=C(OCCO)C=CC1OCCO |
| InChI | InChI=1S/C11H18O4/c1-9-8-10(14-6-4-12)2-3-11(9)15-7-5-13/h2-3,8-9,11-13H,4-7H2,1H3 |
| InChIKey | SOFBRYFVPZAZDV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol?
The IUPAC name of 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol (CID 170389293) is 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol.
What is the SMILES notation for 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol?
The canonical SMILES for 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol is CC1C=C(OCCO)C=CC1OCCO.
What is the InChIKey of 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol?
The InChIKey is SOFBRYFVPZAZDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-9-8-10(14-6-4-12)2-3-11(9)15-7-5-13/h2-3,8-9,11-13H,4-7H2,1H3.
What are the key properties of 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol?
2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol has a molecular weight of 214.26 g/mol, XLogP of 0.46, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-hydroxyethoxy)-6-methylcyclohexa-2,4-dien-1-yl]oxyethanol is sourced from PubChem (CID 170389293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).