C18H19F6N3O3 — CID 170390116
(6R,12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4-diazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,14,16-pentaen-6-ol (PubChem CID 170390116) has the molecular formula C18H19F6N3O3 and a molecular weight of 439.36 g/mol. Its IUPAC name is (6R,12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4-diazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,14,16-pentaen-6-ol.
| Compound Name | (6R,12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4-diazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,14,16-pentaen-6-ol |
|---|---|
| PubChem CID | 170390116 |
| Molecular Formula | C18H19F6N3O3 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | (6R,12R)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4-diazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,14,16-pentaen-6-ol |
| SMILES | C[C@@H]1CCCCC[C@](O)(C(F)(F)F)c2nnc(o2)-c2cc(c(C(F)(F)F)cc2N)O1 |
| InChI | InChI=1S/C18H19F6N3O3/c1-9-5-3-2-4-6-16(28,18(22,23)24)15-27-26-14(30-15)10-7-13(29-9)11(8-12(10)25)17(19,20)21/h7-9,28H,2-6,25H2,1H3/t9-,16-/m1/s1 |
| InChIKey | AQFBWIBDOSVWFZ-JDNHERCYSA-N |
| XLogP | 4.82 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|