C32H30FN5O5S — CID 170390302
(4R)-N-[[2-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-9-ethynyl-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide (PubChem CID 170390302) has the molecular formula C32H30FN5O5S and a molecular weight of 615.69 g/mol. Its IUPAC name is (4R)-N-[[2-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-9-ethynyl-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide.
| Compound Name | (4R)-N-[[2-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-9-ethynyl-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide |
|---|---|
| PubChem CID | 170390302 |
| Molecular Formula | C32H30FN5O5S |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | (4R)-N-[[2-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,6-naphthyridin-7-yl]methyl]-9-ethynyl-4-fluoro-5,5-dioxo-3,4-dihydro-2H-1,5λ6-benzoxathiepine-7-carboxamide |
| SMILES | C#Cc1cc(C(=O)NCc2cc3nc(-c4cccc(N5C[C@@H](C)O[C@@H](C)C5)n4)ccc3cn2)cc2c1OCC[C@H](F)S2(=O)=O |
| InChI | InChI=1S/C32H30FN5O5S/c1-4-21-12-23(13-28-31(21)42-11-10-29(33)44(28,40)41)32(39)35-16-24-14-27-22(15-34-24)8-9-26(36-27)25-6-5-7-30(37-25)38-17-19(2)43-20(3)18-38/h1,5-9,12-15,19-20,29H,10-11,16-18H2,2-3H3,(H,35,39)/t19-,20+,29-/m1/s1 |
| InChIKey | IUGMCBNWXINCSX-WAPJKPAKSA-N |
| XLogP | 4.07 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|