C25H19F3N2 — CID 170390398
2,4,6-triphenyl-5-(trifluoromethyl)benzene-1,3-diamine (PubChem CID 170390398) has the molecular formula C25H19F3N2 and a molecular weight of 404.44 g/mol. Its IUPAC name is 2,4,6-triphenyl-5-(trifluoromethyl)benzene-1,3-diamine.
| Compound Name | 2,4,6-triphenyl-5-(trifluoromethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 170390398 |
| Molecular Formula | C25H19F3N2 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2,4,6-triphenyl-5-(trifluoromethyl)benzene-1,3-diamine |
| SMILES | Nc1c(-c2ccccc2)c(N)c(-c2ccccc2)c(C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C25H19F3N2/c26-25(27,28)22-19(16-10-4-1-5-11-16)23(29)21(18-14-8-3-9-15-18)24(30)20(22)17-12-6-2-7-13-17/h1-15H,29-30H2 |
| InChIKey | CQVUTJWCPKOMCZ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|