C24H42N4 — CID 170390810
(Z)-3-[[(2E)-2-but-3-enyl-4-(2-ethylpent-3-enylamino)-5-methylhexa-2,4-dienyl]amino]-N'-propan-2-ylprop-2-enimidamide (PubChem CID 170390810) has the molecular formula C24H42N4 and a molecular weight of 386.63 g/mol. Its IUPAC name is (Z)-3-[[(2E)-2-but-3-enyl-4-(2-ethylpent-3-enylamino)-5-methylhexa-2,4-dienyl]amino]-N'-propan-2-ylprop-2-enimidamide.
| Compound Name | (Z)-3-[[(2E)-2-but-3-enyl-4-(2-ethylpent-3-enylamino)-5-methylhexa-2,4-dienyl]amino]-N'-propan-2-ylprop-2-enimidamide |
|---|---|
| PubChem CID | 170390810 |
| Molecular Formula | C24H42N4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | (Z)-3-[[(2E)-2-but-3-enyl-4-(2-ethylpent-3-enylamino)-5-methylhexa-2,4-dienyl]amino]-N'-propan-2-ylprop-2-enimidamide |
| SMILES | C=CCC/C(=C\C(NCC(C=CC)CC)=C(C)C)CN/C=C\C(N)=N\C(C)C |
| InChI | InChI=1S/C24H42N4/c1-8-11-13-22(17-26-15-14-24(25)28-20(6)7)16-23(19(4)5)27-18-21(10-3)12-9-2/h8-9,12,14-16,20-21,26-27H,1,10-11,13,17-18H2,2-7H3,(H2,25,28)/b12-9?,15-14-,22-16+ |
| InChIKey | KIKFBZJPCFNPTN-BJKDXVGSSA-N |
| XLogP | 5.23 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|