C15H15FN2S — CID 170390923
S-[4-(6-fluoro-1,2,3,4-tetrahydroquinolin-2-yl)phenyl]thiohydroxylamine (PubChem CID 170390923) has the molecular formula C15H15FN2S and a molecular weight of 274.36 g/mol. Its IUPAC name is S-[4-(6-fluoro-1,2,3,4-tetrahydroquinolin-2-yl)phenyl]thiohydroxylamine.
| Compound Name | S-[4-(6-fluoro-1,2,3,4-tetrahydroquinolin-2-yl)phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 170390923 |
| Molecular Formula | C15H15FN2S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | S-[4-(6-fluoro-1,2,3,4-tetrahydroquinolin-2-yl)phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(C2CCc3cc(F)ccc3N2)cc1 |
| InChI | InChI=1S/C15H15FN2S/c16-12-4-8-15-11(9-12)3-7-14(18-15)10-1-5-13(19-17)6-2-10/h1-2,4-6,8-9,14,18H,3,7,17H2 |
| InChIKey | BVXYLLIMSZWNQR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|