C25H36N4 — CID 170391200
N-[N-[(Z)-hex-2-en-4-ynyl]-C-prop-2-enylcarbonimidoyl]-N'-methyl-3-(methylamino)-4-[(E)-pent-2-enyl]cyclohepta-1,6-diene-1-carboximidamide (PubChem CID 170391200) has the molecular formula C25H36N4 and a molecular weight of 392.59 g/mol. Its IUPAC name is N-[N-[(Z)-hex-2-en-4-ynyl]-C-prop-2-enylcarbonimidoyl]-N'-methyl-3-(methylamino)-4-[(E)-pent-2-enyl]cyclohepta-1,6-diene-1-carboximidamide.
| Compound Name | N-[N-[(Z)-hex-2-en-4-ynyl]-C-prop-2-enylcarbonimidoyl]-N'-methyl-3-(methylamino)-4-[(E)-pent-2-enyl]cyclohepta-1,6-diene-1-carboximidamide |
|---|---|
| PubChem CID | 170391200 |
| Molecular Formula | C25H36N4 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | N-[N-[(Z)-hex-2-en-4-ynyl]-C-prop-2-enylcarbonimidoyl]-N'-methyl-3-(methylamino)-4-[(E)-pent-2-enyl]cyclohepta-1,6-diene-1-carboximidamide |
| SMILES | C=CC/C(=N\C/C=C\C#CC)N/C(=N\C)C1=CC(NC)C(C/C=C/CC)CC=C1 |
| InChI | InChI=1S/C25H36N4/c1-6-9-11-13-19-28-24(15-8-3)29-25(27-5)22-18-14-17-21(16-12-10-7-2)23(20-22)26-4/h8,10-14,18,20-21,23,26H,3,7,15-17,19H2,1-2,4-5H3,(H,27,28,29)/b12-10+,13-11- |
| InChIKey | OCWUADIKTFJLEJ-FAEGWCMCSA-N |
| XLogP | 4.61 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|