C23H22N4OS — CID 17039148
1-(1,3-benzothiazol-2-yl)-N-cyclohexyl-5-phenylpyrazole-3-carboxamide (PubChem CID 17039148) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-cyclohexyl-5-phenylpyrazole-3-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-cyclohexyl-5-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17039148 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-cyclohexyl-5-phenylpyrazole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(-c2ccccc2)n(-c2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C23H22N4OS/c28-22(24-17-11-5-2-6-12-17)19-15-20(16-9-3-1-4-10-16)27(26-19)23-25-18-13-7-8-14-21(18)29-23/h1,3-4,7-10,13-15,17H,2,5-6,11-12H2,(H,24,28) |
| InChIKey | XITVDKIXXBQGIP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |