C29H34N2O2 — CID 170391595
3-[3-[6-(6,6-dimethylheptyl)imidazo[1,2-a]pyridin-2-yl]propanoyl]-8aH-naphthalen-1-one (PubChem CID 170391595) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 3-[3-[6-(6,6-dimethylheptyl)imidazo[1,2-a]pyridin-2-yl]propanoyl]-8aH-naphthalen-1-one.
| Compound Name | 3-[3-[6-(6,6-dimethylheptyl)imidazo[1,2-a]pyridin-2-yl]propanoyl]-8aH-naphthalen-1-one |
|---|---|
| PubChem CID | 170391595 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 3-[3-[6-(6,6-dimethylheptyl)imidazo[1,2-a]pyridin-2-yl]propanoyl]-8aH-naphthalen-1-one |
| SMILES | CC(C)(C)CCCCCc1ccc2nc(CCC(=O)C3=CC(=O)C4C=CC=CC4=C3)cn2c1 |
| InChI | InChI=1S/C29H34N2O2/c1-29(2,3)16-8-4-5-9-21-12-15-28-30-24(20-31(28)19-21)13-14-26(32)23-17-22-10-6-7-11-25(22)27(33)18-23/h6-7,10-12,15,17-20,25H,4-5,8-9,13-14,16H2,1-3H3 |
| InChIKey | BJZHGZZWQKXGRK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|