About N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide
N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide (PubChem CID 170391703) has the molecular formula C18H13N3O4
and a molecular weight of 335.32 g/mol. Its IUPAC name is N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide |
| PubChem CID | 170391703 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(NCc1cn2cc(O)ccc2n1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C18H13N3O4/c22-12-5-6-17-20-11(9-21(17)10-12)8-19-18(24)16-7-14(23)13-3-1-2-4-15(13)25-16/h1-7,9-10,22H,8H2,(H,19,24) |
| InChIKey | IRFQPQJRZMSEAH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide?
The IUPAC name of N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide (CID 170391703) is N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide.
What is the SMILES notation for N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide?
The canonical SMILES for N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide is O=C(NCc1cn2cc(O)ccc2n1)c1cc(=O)c2ccccc2o1.
What is the InChIKey of N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide?
The InChIKey is IRFQPQJRZMSEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O4/c22-12-5-6-17-20-11(9-21(17)10-12)8-19-18(24)16-7-14(23)13-3-1-2-4-15(13)25-16/h1-7,9-10,22H,8H2,(H,19,24).
What are the key properties of N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide?
N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide has a molecular weight of 335.32 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-hydroxyimidazo[1,2-a]pyridin-2-yl)methyl]-4-oxochromene-2-carboxamide is sourced from PubChem (CID 170391703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).