C24H32N2O3 — CID 170392004
N-[3-(4-cyano-3-methylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-2-methyl-4-methylidene-5-oxohexanamide (PubChem CID 170392004) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-[3-(4-cyano-3-methylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-2-methyl-4-methylidene-5-oxohexanamide.
| Compound Name | N-[3-(4-cyano-3-methylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-2-methyl-4-methylidene-5-oxohexanamide |
|---|---|
| PubChem CID | 170392004 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-[3-(4-cyano-3-methylphenoxy)-2,2,4,4-tetramethylcyclobutyl]-2-methyl-4-methylidene-5-oxohexanamide |
| SMILES | C=C(CC(C)C(=O)NC1C(C)(C)C(Oc2ccc(C#N)c(C)c2)C1(C)C)C(C)=O |
| InChI | InChI=1S/C24H32N2O3/c1-14(17(4)27)11-16(3)20(28)26-21-23(5,6)22(24(21,7)8)29-19-10-9-18(13-25)15(2)12-19/h9-10,12,16,21-22H,1,11H2,2-8H3,(H,26,28) |
| InChIKey | NVBDKGQZWDYWKE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|