C18H20BrClN2O2 — CID 170392253
methyl 2-[2-(2-bromo-5-chloroanilino)ethylamino]-3-phenylpropanoate (PubChem CID 170392253) has the molecular formula C18H20BrClN2O2 and a molecular weight of 411.73 g/mol. Its IUPAC name is methyl 2-[2-(2-bromo-5-chloroanilino)ethylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[2-(2-bromo-5-chloroanilino)ethylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 170392253 |
| Molecular Formula | C18H20BrClN2O2 |
| Molecular Weight | 411.73 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | methyl 2-[2-(2-bromo-5-chloroanilino)ethylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NCCNc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C18H20BrClN2O2/c1-24-18(23)17(11-13-5-3-2-4-6-13)22-10-9-21-16-12-14(20)7-8-15(16)19/h2-8,12,17,21-22H,9-11H2,1H3 |
| InChIKey | RHOMSAVAPXADOT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|