C27H31F2N5O — CID 170392337
(3,3-difluorocyclobutyl)-[5-[4-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]amino]-2,5,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]methanone (PubChem CID 170392337) has the molecular formula C27H31F2N5O and a molecular weight of 479.58 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[5-[4-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]amino]-2,5,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]methanone.
| Compound Name | (3,3-difluorocyclobutyl)-[5-[4-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]amino]-2,5,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]methanone |
|---|---|
| PubChem CID | 170392337 |
| Molecular Formula | C27H31F2N5O |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[5-[4-[[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]amino]-2,5,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]methanone |
| SMILES | C=C(C)/C=C\C(=C/C)NC1=NC(c2ccc3c(c2)CN(C(=O)C2CC(F)(F)C2)C3)NC2=C1CNC2 |
| InChI | InChI=1S/C27H31F2N5O/c1-4-21(8-5-16(2)3)31-25-22-12-30-13-23(22)32-24(33-25)17-6-7-18-14-34(15-19(18)9-17)26(35)20-10-27(28,29)11-20/h4-9,20,24,30,32H,2,10-15H2,1,3H3,(H,31,33)/b8-5-,21-4+ |
| InChIKey | ISPNLMZYOMAEFJ-XIKVBVDDSA-N |
| XLogP | 4.06 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|