C30H32O4 — CID 170392392
3-[5-[(2,2-dihydroxycyclopentyl)methoxymethyl]-3aH-inden-2-yl]-1-(4-methylidene-4aH-naphthalen-2-yl)propan-1-one (PubChem CID 170392392) has the molecular formula C30H32O4 and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-[5-[(2,2-dihydroxycyclopentyl)methoxymethyl]-3aH-inden-2-yl]-1-(4-methylidene-4aH-naphthalen-2-yl)propan-1-one.
| Compound Name | 3-[5-[(2,2-dihydroxycyclopentyl)methoxymethyl]-3aH-inden-2-yl]-1-(4-methylidene-4aH-naphthalen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 170392392 |
| Molecular Formula | C30H32O4 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-[5-[(2,2-dihydroxycyclopentyl)methoxymethyl]-3aH-inden-2-yl]-1-(4-methylidene-4aH-naphthalen-2-yl)propan-1-one |
| SMILES | C=C1C=C(C(=O)CCC2=CC3C=C(COCC4CCCC4(O)O)C=CC3=C2)C=C2C=CC=CC12 |
| InChI | InChI=1S/C30H32O4/c1-20-13-26(17-24-5-2-3-7-28(20)24)29(31)11-9-21-14-23-10-8-22(16-25(23)15-21)18-34-19-27-6-4-12-30(27,32)33/h2-3,5,7-8,10,13-17,25,27-28,32-33H,1,4,6,9,11-12,18-19H2 |
| InChIKey | ZDCKBBVUZUHZKT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|