C18H34N4 — CID 170392485
3'-tert-butyl-6,6-dimethylspiro[1,2,3,4,7,8a-hexahydropyrrolo[1,2-a]pyrazine-8,6'-3,8-diazabicyclo[3.2.1]octane] (PubChem CID 170392485) has the molecular formula C18H34N4 and a molecular weight of 306.50 g/mol. Its IUPAC name is 3'-tert-butyl-6,6-dimethylspiro[1,2,3,4,7,8a-hexahydropyrrolo[1,2-a]pyrazine-8,6'-3,8-diazabicyclo[3.2.1]octane].
| Compound Name | 3'-tert-butyl-6,6-dimethylspiro[1,2,3,4,7,8a-hexahydropyrrolo[1,2-a]pyrazine-8,6'-3,8-diazabicyclo[3.2.1]octane] |
|---|---|
| PubChem CID | 170392485 |
| Molecular Formula | C18H34N4 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | 3'-tert-butyl-6,6-dimethylspiro[1,2,3,4,7,8a-hexahydropyrrolo[1,2-a]pyrazine-8,6'-3,8-diazabicyclo[3.2.1]octane] |
| SMILES | CC(C)(C)N1CC2CC3(CC(C)(C)N4CCNCC43)C(C1)N2 |
| InChI | InChI=1S/C18H34N4/c1-16(2,3)21-10-13-8-18(14(11-21)20-13)12-17(4,5)22-7-6-19-9-15(18)22/h13-15,19-20H,6-12H2,1-5H3 |
| InChIKey | KHHCHEQEOFBTMV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |