About N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine
N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine (PubChem CID 170392911) has the molecular formula C15H23FN2
and a molecular weight of 250.36 g/mol. Its IUPAC name is N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine |
| PubChem CID | 170392911 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine |
| SMILES | C[C@H](CC1=CNC2C=CC=CC12)NCC(C)(C)F |
| InChI | InChI=1S/C15H23FN2/c1-11(18-10-15(2,3)16)8-12-9-17-14-7-5-4-6-13(12)14/h4-7,9,11,13-14,17-18H,8,10H2,1-3H3/t11-,13?,14?/m1/s1 |
| InChIKey | LDWBAVPSLYVJIX-LMWSTFAQSA-N |
| XLogP | 2.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine?
The IUPAC name of N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine (CID 170392911) is N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine.
What is the SMILES notation for N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine?
The canonical SMILES for N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine is C[C@H](CC1=CNC2C=CC=CC12)NCC(C)(C)F.
What is the InChIKey of N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine?
The InChIKey is LDWBAVPSLYVJIX-LMWSTFAQSA-N. The full InChI is InChI=1S/C15H23FN2/c1-11(18-10-15(2,3)16)8-12-9-17-14-7-5-4-6-13(12)14/h4-7,9,11,13-14,17-18H,8,10H2,1-3H3/t11-,13?,14?/m1/s1.
What are the key properties of N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine?
N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine has a molecular weight of 250.36 g/mol, XLogP of 2.70, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1-(3a,7a-dihydro-1H-indol-3-yl)propan-2-yl]-2-fluoro-2-methylpropan-1-amine is sourced from PubChem (CID 170392911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).