C22H33I3N2O4S — CID 170393140
(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[[2,4,6-triiodo-3-(methanesulfonamido)phenyl]methyl]butanoate (PubChem CID 170393140) has the molecular formula C22H33I3N2O4S and a molecular weight of 802.29 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[[2,4,6-triiodo-3-(methanesulfonamido)phenyl]methyl]butanoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[[2,4,6-triiodo-3-(methanesulfonamido)phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 170393140 |
| Molecular Formula | C22H33I3N2O4S |
| Molecular Weight | 802.29 g/mol |
| Exact Mass | 801.93 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[[2,4,6-triiodo-3-(methanesulfonamido)phenyl]methyl]butanoate |
| SMILES | CCC(Cc1c(I)cc(I)c(NS(C)(=O)=O)c1I)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C22H33I3N2O4S/c1-8-13(20(28)31-14-11-21(2,3)27(6)22(4,5)12-14)9-15-16(23)10-17(24)19(18(15)25)26-32(7,29)30/h10,13-14,26H,8-9,11-12H2,1-7H3 |
| InChIKey | JVGPNNZXEFVDMU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.29 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|