C12H17FN2 — CID 170393226
(1Z,3Z,4Z)-3-(1-fluoroprop-2-enylidene)-1-N,2-N-dimethylhepta-1,4,6-triene-1,2-diamine (PubChem CID 170393226) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is (1Z,3Z,4Z)-3-(1-fluoroprop-2-enylidene)-1-N,2-N-dimethylhepta-1,4,6-triene-1,2-diamine.
| Compound Name | (1Z,3Z,4Z)-3-(1-fluoroprop-2-enylidene)-1-N,2-N-dimethylhepta-1,4,6-triene-1,2-diamine |
|---|---|
| PubChem CID | 170393226 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (1Z,3Z,4Z)-3-(1-fluoroprop-2-enylidene)-1-N,2-N-dimethylhepta-1,4,6-triene-1,2-diamine |
| SMILES | C=C/C=C\C(\C(=C\NC)NC)=C(\F)C=C |
| InChI | InChI=1S/C12H17FN2/c1-5-7-8-10(11(13)6-2)12(15-4)9-14-3/h5-9,14-15H,1-2H2,3-4H3/b8-7-,11-10-,12-9- |
| InChIKey | COBWOYQGNOJUHU-WUXJQWPISA-N |
| XLogP | 2.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|