C25H20F4N2O3S — CID 170393340
5-fluoro-2-methyl-1-[5-(2,3,6-trifluorophenyl)-2,3-dihydro-1H-indene-2-carbonyl]-2,3-dihydroindole-6-sulfonamide (PubChem CID 170393340) has the molecular formula C25H20F4N2O3S and a molecular weight of 504.51 g/mol. Its IUPAC name is 5-fluoro-2-methyl-1-[5-(2,3,6-trifluorophenyl)-2,3-dihydro-1H-indene-2-carbonyl]-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 5-fluoro-2-methyl-1-[5-(2,3,6-trifluorophenyl)-2,3-dihydro-1H-indene-2-carbonyl]-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 170393340 |
| Molecular Formula | C25H20F4N2O3S |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 5-fluoro-2-methyl-1-[5-(2,3,6-trifluorophenyl)-2,3-dihydro-1H-indene-2-carbonyl]-2,3-dihydroindole-6-sulfonamide |
| SMILES | CC1Cc2cc(F)c(S(N)(=O)=O)cc2N1C(=O)C1Cc2ccc(-c3c(F)ccc(F)c3F)cc2C1 |
| InChI | InChI=1S/C25H20F4N2O3S/c1-12-6-16-10-20(28)22(35(30,33)34)11-21(16)31(12)25(32)17-7-13-2-3-14(8-15(13)9-17)23-18(26)4-5-19(27)24(23)29/h2-5,8,10-12,17H,6-7,9H2,1H3,(H2,30,33,34) |
| InChIKey | AQIOTNKTZIRIHL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|