C37H50I4N2O5 — CID 170394548
(2-iodophenyl) 2-[3-[6-tert-butyl-1-hydroxy-4-(2,3,5-triiodobenzoyl)oxypiperidin-2-yl]-3-methylbutyl]-1,2,6,6-tetramethylpiperidine-4-carboxylate (PubChem CID 170394548) has the molecular formula C37H50I4N2O5 and a molecular weight of 1110.43 g/mol. Its IUPAC name is (2-iodophenyl) 2-[3-[6-tert-butyl-1-hydroxy-4-(2,3,5-triiodobenzoyl)oxypiperidin-2-yl]-3-methylbutyl]-1,2,6,6-tetramethylpiperidine-4-carboxylate.
| Compound Name | (2-iodophenyl) 2-[3-[6-tert-butyl-1-hydroxy-4-(2,3,5-triiodobenzoyl)oxypiperidin-2-yl]-3-methylbutyl]-1,2,6,6-tetramethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 170394548 |
| Molecular Formula | C37H50I4N2O5 |
| Molecular Weight | 1110.43 g/mol |
| Exact Mass | 1109.99 |
| IUPAC Name | (2-iodophenyl) 2-[3-[6-tert-butyl-1-hydroxy-4-(2,3,5-triiodobenzoyl)oxypiperidin-2-yl]-3-methylbutyl]-1,2,6,6-tetramethylpiperidine-4-carboxylate |
| SMILES | CN1C(C)(C)CC(C(=O)Oc2ccccc2I)CC1(C)CCC(C)(C)C1CC(OC(=O)c2cc(I)cc(I)c2I)CC(C(C)(C)C)N1O |
| InChI | InChI=1S/C37H50I4N2O5/c1-34(2,3)29-18-24(47-33(45)25-16-23(38)17-27(40)31(25)41)19-30(43(29)46)35(4,5)14-15-37(8)21-22(20-36(6,7)42(37)9)32(44)48-28-13-11-10-12-26(28)39/h10-13,16-17,22,24,29-30,46H,14-15,18-21H2,1-9H3 |
| InChIKey | CZYCGMRKQYAGKA-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.43 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|