C14H17F3N6O — CID 170394631
(11R)-4,6,11-trimethyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),4,13(17),14-pentaene (PubChem CID 170394631) has the molecular formula C14H17F3N6O and a molecular weight of 342.33 g/mol. Its IUPAC name is (11R)-4,6,11-trimethyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),4,13(17),14-pentaene.
| Compound Name | (11R)-4,6,11-trimethyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),4,13(17),14-pentaene |
|---|---|
| PubChem CID | 170394631 |
| Molecular Formula | C14H17F3N6O |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (11R)-4,6,11-trimethyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3(7),4,13(17),14-pentaene |
| SMILES | Cc1nn(C)c2c1Nc1ncc(C(F)(F)F)c(n1)N[C@H](C)CCO2 |
| InChI | InChI=1S/C14H17F3N6O/c1-7-4-5-24-12-10(8(2)22-23(12)3)20-13-18-6-9(14(15,16)17)11(19-7)21-13/h6-7H,4-5H2,1-3H3,(H2,18,19,20,21)/t7-/m1/s1 |
| InChIKey | GKTKAYXVHZHUEP-SSDOTTSWSA-N |
| XLogP | 2.86 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |