C21H22N3O+ — CID 17039487
(1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene (PubChem CID 17039487) has the molecular formula C21H22N3O+ and a molecular weight of 332.43 g/mol. Its IUPAC name is (1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene.
| Compound Name | (1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
|---|---|
| PubChem CID | 17039487 |
| Molecular Formula | C21H22N3O+ |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (1R,9S)-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)CO[C@H]2Cc4ccccc4[C@H]23)c(C)c1 |
| InChI | InChI=1S/C21H22N3O/c1-13-8-14(2)20(15(3)9-13)24-12-23-19(22-24)11-25-18-10-16-6-4-5-7-17(16)21(18)23/h4-9,12,18,21H,10-11H2,1-3H3/q+1/t18-,21+/m0/s1 |
| InChIKey | UPMQYCYBLZEXEV-GHTZIAJQSA-N |
| XLogP | 3.13 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|