C28H53N — CID 170394889
(5E,9E)-5,9,12-trimethyl-N-nonan-2-ylhexadeca-5,9-dien-2-imine (PubChem CID 170394889) has the molecular formula C28H53N and a molecular weight of 403.74 g/mol. Its IUPAC name is (5E,9E)-5,9,12-trimethyl-N-nonan-2-ylhexadeca-5,9-dien-2-imine.
| Compound Name | (5E,9E)-5,9,12-trimethyl-N-nonan-2-ylhexadeca-5,9-dien-2-imine |
|---|---|
| PubChem CID | 170394889 |
| Molecular Formula | C28H53N |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 403.42 |
| IUPAC Name | (5E,9E)-5,9,12-trimethyl-N-nonan-2-ylhexadeca-5,9-dien-2-imine |
| SMILES | CCCCCCCC(C)/N=C(\C)CC/C(C)=C/CC/C(C)=C/CC(C)CCCC |
| InChI | InChI=1S/C28H53N/c1-8-10-12-13-14-19-27(6)29-28(7)23-22-26(5)18-15-17-25(4)21-20-24(3)16-11-9-2/h18,21,24,27H,8-17,19-20,22-23H2,1-7H3/b25-21+,26-18+,29-28+ |
| InChIKey | QFJOSKARBJDEBD-QBHRAYSWSA-N |
| XLogP | 9.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|