C24H24N4O5S2 — CID 170395235
N-[[(3aS,4S,6R,6aR)-4-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-sulfonamide (PubChem CID 170395235) has the molecular formula C24H24N4O5S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-[[(3aS,4S,6R,6aR)-4-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[(3aS,4S,6R,6aR)-4-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 170395235 |
| Molecular Formula | C24H24N4O5S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | N-[[(3aS,4S,6R,6aR)-4-(4-aminothieno[3,2-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-sulfonamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CNS(=O)(=O)c1ccc3ccccc3c1)O[C@H]2c1csc2c(N)ncnc12 |
| InChI | InChI=1S/C24H24N4O5S2/c1-24(2)32-20-17(10-28-35(29,30)15-8-7-13-5-3-4-6-14(13)9-15)31-19(21(20)33-24)16-11-34-22-18(16)26-12-27-23(22)25/h3-9,11-12,17,19-21,28H,10H2,1-2H3,(H2,25,26,27)/t17-,19+,20-,21+/m1/s1 |
| InChIKey | GTFOXCDFYSOBLF-PMXSJFBMSA-N |
| XLogP | 3.37 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |