C9H16F3NO — CID 170395552
(3S)-4-propan-2-yl-3-(2,2,2-trifluoroethyl)morpholine (PubChem CID 170395552) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is (3S)-4-propan-2-yl-3-(2,2,2-trifluoroethyl)morpholine.
| Compound Name | (3S)-4-propan-2-yl-3-(2,2,2-trifluoroethyl)morpholine |
|---|---|
| PubChem CID | 170395552 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (3S)-4-propan-2-yl-3-(2,2,2-trifluoroethyl)morpholine |
| SMILES | CC(C)N1CCOC[C@@H]1CC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c1-7(2)13-3-4-14-6-8(13)5-9(10,11)12/h7-8H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | UBJWHWKIHBDNGD-QMMMGPOBSA-N |
| XLogP | 2.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |