C25H20F9N4+ — CID 170395575
5-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-2,3,8-tris(trifluoromethyl)pyrazino[2,3-d]pyridazin-6-ium (PubChem CID 170395575) has the molecular formula C25H20F9N4+ and a molecular weight of 547.45 g/mol. Its IUPAC name is 5-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-2,3,8-tris(trifluoromethyl)pyrazino[2,3-d]pyridazin-6-ium.
| Compound Name | 5-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-2,3,8-tris(trifluoromethyl)pyrazino[2,3-d]pyridazin-6-ium |
|---|---|
| PubChem CID | 170395575 |
| Molecular Formula | C25H20F9N4+ |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 5-(4-tert-butyl-1-methylnaphthalen-2-yl)-6-methyl-2,3,8-tris(trifluoromethyl)pyrazino[2,3-d]pyridazin-6-ium |
| SMILES | Cc1c(-c2c3nc(C(F)(F)F)c(C(F)(F)F)nc3c(C(F)(F)F)n[n+]2C)cc(C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C25H20F9N4/c1-11-12-8-6-7-9-13(12)15(22(2,3)4)10-14(11)18-16-17(19(23(26,27)28)37-38(18)5)36-21(25(32,33)34)20(35-16)24(29,30)31/h6-10H,1-5H3/q+1 |
| InChIKey | QXJFRFPREUKULT-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|