About 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol
6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol (PubChem CID 17039583) has the molecular formula C17H10F6N2O
and a molecular weight of 372.27 g/mol. Its IUPAC name is 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol |
| PubChem CID | 17039583 |
| Molecular Formula | C17H10F6N2O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol |
| SMILES | Oc1ccc(Cc2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)nc1 |
| InChI | InChI=1S/C17H10F6N2O/c18-16(19,20)13-3-1-2-12-9(6-10-4-5-11(26)8-24-10)7-14(17(21,22)23)25-15(12)13/h1-5,7-8,26H,6H2 |
| InChIKey | ASDDZKNGQMDDPD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol?
The IUPAC name of 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol (CID 17039583) is 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol.
What is the SMILES notation for 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol?
The canonical SMILES for 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol is Oc1ccc(Cc2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)nc1.
What is the InChIKey of 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol?
The InChIKey is ASDDZKNGQMDDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F6N2O/c18-16(19,20)13-3-1-2-12-9(6-10-4-5-11(26)8-24-10)7-14(17(21,22)23)25-15(12)13/h1-5,7-8,26H,6H2.
What are the key properties of 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol?
6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol has a molecular weight of 372.27 g/mol, XLogP of 4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl]pyridin-3-ol is sourced from PubChem (CID 17039583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).