C22H26F2N2O2 — CID 170395988
(2S,3R,4S)-3-(3,4-difluoro-2-methylphenyl)-N-(6-ethyl-3-pyridinyl)-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170395988) has the molecular formula C22H26F2N2O2 and a molecular weight of 388.46 g/mol. Its IUPAC name is (2S,3R,4S)-3-(3,4-difluoro-2-methylphenyl)-N-(6-ethyl-3-pyridinyl)-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2S,3R,4S)-3-(3,4-difluoro-2-methylphenyl)-N-(6-ethyl-3-pyridinyl)-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170395988 |
| Molecular Formula | C22H26F2N2O2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (2S,3R,4S)-3-(3,4-difluoro-2-methylphenyl)-N-(6-ethyl-3-pyridinyl)-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)[C@H]2OC(C)(C)[C@@H](C)[C@@H]2c2ccc(F)c(F)c2C)cn1 |
| InChI | InChI=1S/C22H26F2N2O2/c1-6-14-7-8-15(11-25-14)26-21(27)20-18(13(3)22(4,5)28-20)16-9-10-17(23)19(24)12(16)2/h7-11,13,18,20H,6H2,1-5H3,(H,26,27)/t13-,18+,20-/m0/s1 |
| InChIKey | LWPCYAMIKBKKFB-VIZZQPHQSA-N |
| XLogP | 4.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |