About 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine
1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine (PubChem CID 170396241) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine |
| PubChem CID | 170396241 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine |
| SMILES | Cn1ccc(NCC2C[C@@H]3CC[C@]2(C)C3)n1 |
| InChI | InChI=1S/C13H21N3/c1-13-5-3-10(8-13)7-11(13)9-14-12-4-6-16(2)15-12/h4,6,10-11H,3,5,7-9H2,1-2H3,(H,14,15)/t10-,11?,13+/m0/s1 |
| InChIKey | OOCIYCRCXQOMRP-CCQDYZPNSA-N |
| XLogP | 2.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine?
The IUPAC name of 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine (CID 170396241) is 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine.
What is the SMILES notation for 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine?
The canonical SMILES for 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine is Cn1ccc(NCC2C[C@@H]3CC[C@]2(C)C3)n1.
What is the InChIKey of 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine?
The InChIKey is OOCIYCRCXQOMRP-CCQDYZPNSA-N. The full InChI is InChI=1S/C13H21N3/c1-13-5-3-10(8-13)7-11(13)9-14-12-4-6-16(2)15-12/h4,6,10-11H,3,5,7-9H2,1-2H3,(H,14,15)/t10-,11?,13+/m0/s1.
What are the key properties of 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine?
1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine has a molecular weight of 219.33 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[[(1R,4S)-1-methyl-2-bicyclo[2.2.1]heptanyl]methyl]pyrazol-3-amine is sourced from PubChem (CID 170396241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).