C19H23F3N6O — CID 170396845
4-cyclobutyl-6-methyl-17-(trifluoromethyl)-12-oxa-2,4,5,15,19,20-hexazatetracyclo[14.3.1.03,7.010,14]icosa-1(19),3(7),5,16(20),17-pentaene (PubChem CID 170396845) has the molecular formula C19H23F3N6O and a molecular weight of 408.43 g/mol. Its IUPAC name is 4-cyclobutyl-6-methyl-17-(trifluoromethyl)-12-oxa-2,4,5,15,19,20-hexazatetracyclo[14.3.1.03,7.010,14]icosa-1(19),3(7),5,16(20),17-pentaene.
| Compound Name | 4-cyclobutyl-6-methyl-17-(trifluoromethyl)-12-oxa-2,4,5,15,19,20-hexazatetracyclo[14.3.1.03,7.010,14]icosa-1(19),3(7),5,16(20),17-pentaene |
|---|---|
| PubChem CID | 170396845 |
| Molecular Formula | C19H23F3N6O |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-cyclobutyl-6-methyl-17-(trifluoromethyl)-12-oxa-2,4,5,15,19,20-hexazatetracyclo[14.3.1.03,7.010,14]icosa-1(19),3(7),5,16(20),17-pentaene |
| SMILES | Cc1nn(C2CCC2)c2c1CCC1COCC1Nc1nc(ncc1C(F)(F)F)N2 |
| InChI | InChI=1S/C19H23F3N6O/c1-10-13-6-5-11-8-29-9-15(11)24-16-14(19(20,21)22)7-23-18(25-16)26-17(13)28(27-10)12-3-2-4-12/h7,11-12,15H,2-6,8-9H2,1H3,(H2,23,24,25,26) |
| InChIKey | OZHCUULAIKCTAI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |