C19H34O4 — CID 170400283
(4S,5R,6R)-4,5,6-tributoxy-3-methylcyclohex-2-en-1-one (PubChem CID 170400283) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (4S,5R,6R)-4,5,6-tributoxy-3-methylcyclohex-2-en-1-one.
| Compound Name | (4S,5R,6R)-4,5,6-tributoxy-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 170400283 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (4S,5R,6R)-4,5,6-tributoxy-3-methylcyclohex-2-en-1-one |
| SMILES | CCCCO[C@H]1[C@@H](OCCCC)C(=O)C=C(C)[C@@H]1OCCCC |
| InChI | InChI=1S/C19H34O4/c1-5-8-11-21-17-15(4)14-16(20)18(22-12-9-6-2)19(17)23-13-10-7-3/h14,17-19H,5-13H2,1-4H3/t17-,18-,19+/m0/s1 |
| InChIKey | YIEVMFRYFTXCGH-GBESFXJTSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|