C19H36O5 — CID 170400287
(2R,3S,4R)-2,3,4-tributoxy-5-hydroxy-5-methylcyclohexan-1-one (PubChem CID 170400287) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,4-tributoxy-5-hydroxy-5-methylcyclohexan-1-one.
| Compound Name | (2R,3S,4R)-2,3,4-tributoxy-5-hydroxy-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 170400287 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (2R,3S,4R)-2,3,4-tributoxy-5-hydroxy-5-methylcyclohexan-1-one |
| SMILES | CCCCOC1[C@@H](OCCCC)C(C)(O)CC(=O)[C@@H]1OCCCC |
| InChI | InChI=1S/C19H36O5/c1-5-8-11-22-16-15(20)14-19(4,21)18(24-13-10-7-3)17(16)23-12-9-6-2/h16-18,21H,5-14H2,1-4H3/t16-,17?,18+,19?/m0/s1 |
| InChIKey | SPQOAUYMIHAKRO-BKVYNOPKSA-N |
| XLogP | 3.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|