C17H26N2O4 — CID 170400768
N-(4-methylphenyl)-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide (PubChem CID 170400768) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide.
| Compound Name | N-(4-methylphenyl)-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 170400768 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-(4-methylphenyl)-3-[2-[2-(propanoylamino)ethoxy]ethoxy]propanamide |
| SMILES | CCC(=O)NCCOCCOCCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C17H26N2O4/c1-3-16(20)18-9-11-23-13-12-22-10-8-17(21)19-15-6-4-14(2)5-7-15/h4-7H,3,8-13H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | HLGLMPZRGGUBRX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|