C51H32N6O2 — CID 170401429
10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,20-diphenyl-10,13,20-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4,6,8,14,16,18-octaene-12,21-dione (PubChem CID 170401429) has the molecular formula C51H32N6O2 and a molecular weight of 760.86 g/mol. Its IUPAC name is 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,20-diphenyl-10,13,20-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4,6,8,14,16,18-octaene-12,21-dione.
| Compound Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,20-diphenyl-10,13,20-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4,6,8,14,16,18-octaene-12,21-dione |
|---|---|
| PubChem CID | 170401429 |
| Molecular Formula | C51H32N6O2 |
| Molecular Weight | 760.86 g/mol |
| Exact Mass | 760.26 |
| IUPAC Name | 10-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,20-diphenyl-10,13,20-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4,6,8,14,16,18-octaene-12,21-dione |
| SMILES | O=c1c2c(-c3ccccc3)c3c4ccccc4n(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3c(=O)n2c2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C51H32N6O2/c58-50-45-43(33-18-5-1-6-19-33)44-39-28-13-14-29-40(39)55(46(44)51(59)57(45)42-31-16-15-30-41(42)56(50)37-25-11-4-12-26-37)38-27-17-24-36(32-38)49-53-47(34-20-7-2-8-21-34)52-48(54-49)35-22-9-3-10-23-35/h1-32H |
| InChIKey | SRBRGXRPJKQOAL-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.86 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|