C16H16F5IO3 — CID 170402376
[2-iodo-6-methyl-4-(1,1,1,3,3-pentafluorobutan-2-yloxymethyl)phenyl] 2-methylprop-2-enoate (PubChem CID 170402376) has the molecular formula C16H16F5IO3 and a molecular weight of 478.20 g/mol. Its IUPAC name is [2-iodo-6-methyl-4-(1,1,1,3,3-pentafluorobutan-2-yloxymethyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-iodo-6-methyl-4-(1,1,1,3,3-pentafluorobutan-2-yloxymethyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170402376 |
| Molecular Formula | C16H16F5IO3 |
| Molecular Weight | 478.20 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | [2-iodo-6-methyl-4-(1,1,1,3,3-pentafluorobutan-2-yloxymethyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C)cc(COC(C(C)(F)F)C(F)(F)F)cc1I |
| InChI | InChI=1S/C16H16F5IO3/c1-8(2)13(23)25-12-9(3)5-10(6-11(12)22)7-24-14(15(4,17)18)16(19,20)21/h5-6,14H,1,7H2,2-4H3 |
| InChIKey | CYHBUVSCSMSZNB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|