C18H30O2 — CID 170402507
2,2,7,7-tetraethyl-3,3a,4,5,6,8a-hexahydroazulene-1,8-dione (PubChem CID 170402507) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2,2,7,7-tetraethyl-3,3a,4,5,6,8a-hexahydroazulene-1,8-dione.
| Compound Name | 2,2,7,7-tetraethyl-3,3a,4,5,6,8a-hexahydroazulene-1,8-dione |
|---|---|
| PubChem CID | 170402507 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2,2,7,7-tetraethyl-3,3a,4,5,6,8a-hexahydroazulene-1,8-dione |
| SMILES | CCC1(CC)CCCC2CC(CC)(CC)C(=O)C2C1=O |
| InChI | InChI=1S/C18H30O2/c1-5-17(6-2)11-9-10-13-12-18(7-3,8-4)16(20)14(13)15(17)19/h13-14H,5-12H2,1-4H3 |
| InChIKey | GPBRTRWMUUXKME-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|