C23H41N — CID 170402703
3-[(1E,6Z)-6-butan-2-yl-4-ethyl-2,3,9-trimethylcyclonona-1,6-dien-1-yl]-2-methylbutan-1-imine (PubChem CID 170402703) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is 3-[(1E,6Z)-6-butan-2-yl-4-ethyl-2,3,9-trimethylcyclonona-1,6-dien-1-yl]-2-methylbutan-1-imine.
| Compound Name | 3-[(1E,6Z)-6-butan-2-yl-4-ethyl-2,3,9-trimethylcyclonona-1,6-dien-1-yl]-2-methylbutan-1-imine |
|---|---|
| PubChem CID | 170402703 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | 3-[(1E,6Z)-6-butan-2-yl-4-ethyl-2,3,9-trimethylcyclonona-1,6-dien-1-yl]-2-methylbutan-1-imine |
| SMILES | [H]/N=C/C(C)C(C)/C1=C(/C)C(C)C(CC)C/C(C(C)CC)=C/CC1C |
| InChI | InChI=1S/C23H41N/c1-9-15(3)22-12-11-16(4)23(18(6)17(5)14-24)20(8)19(7)21(10-2)13-22/h12,14-19,21,24H,9-11,13H2,1-8H3/b22-12-,23-20-,24-14+ |
| InChIKey | XQALTOLRQCILAM-ARCDFFSMSA-N |
| XLogP | 7.29 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|