C34H27F3 — CID 170402900
(1E,3Z,5Z)-1-[4-[3-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]phenyl]phenyl]cycloocta-1,3,5-triene (PubChem CID 170402900) has the molecular formula C34H27F3 and a molecular weight of 492.58 g/mol. Its IUPAC name is (1E,3Z,5Z)-1-[4-[3-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]phenyl]phenyl]cycloocta-1,3,5-triene.
| Compound Name | (1E,3Z,5Z)-1-[4-[3-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]phenyl]phenyl]cycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 170402900 |
| Molecular Formula | C34H27F3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (1E,3Z,5Z)-1-[4-[3-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]phenyl]phenyl]cycloocta-1,3,5-triene |
| SMILES | FC(F)(F)Cc1ccc(-c2ccc(-c3cccc(-c4ccc(/C5=C/C=C\C=C/CC5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C34H27F3/c35-34(36,37)24-25-11-13-27(14-12-25)29-17-21-31(22-18-29)33-10-6-9-32(23-33)30-19-15-28(16-20-30)26-7-4-2-1-3-5-8-26/h1-4,6-7,9-23H,5,8,24H2/b3-1-,4-2-,26-7+ |
| InChIKey | VXIYZVHUYUXTEW-LWJFDONPSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |