C21H24Cl2N4O7P2 — CID 170403027
[[(3S,5S)-5-[2-chloro-4-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 170403027) has the molecular formula C21H24Cl2N4O7P2 and a molecular weight of 577.30 g/mol. Its IUPAC name is [[(3S,5S)-5-[2-chloro-4-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(3S,5S)-5-[2-chloro-4-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 170403027 |
| Molecular Formula | C21H24Cl2N4O7P2 |
| Molecular Weight | 577.30 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | [[(3S,5S)-5-[2-chloro-4-[[(1S)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-3-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@@H]1CO[C@H](c2ccc3c(N[C@H]4CCc5cc(Cl)ccc54)nc(Cl)nn23)C1 |
| InChI | InChI=1S/C21H24Cl2N4O7P2/c22-14-2-3-15-13(8-14)1-4-16(15)24-20-18-6-5-17(27(18)26-21(23)25-20)19-7-12(9-33-19)10-34-36(31,32)11-35(28,29)30/h2-3,5-6,8,12,16,19H,1,4,7,9-11H2,(H,31,32)(H,24,25,26)(H2,28,29,30)/t12-,16-,19-/m0/s1 |
| InChIKey | HAVBWGVIEZNORC-UVIMBBFXSA-N |
| XLogP | 4.55 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|